C14H19NO5S — CID 110631332
(4-methoxy-3-methylsulfonylphenyl)-(2-methylmorpholin-4-yl)methanone (PubChem CID 110631332) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is (4-methoxy-3-methylsulfonylphenyl)-(2-methylmorpholin-4-yl)methanone.
| Compound Name | (4-methoxy-3-methylsulfonylphenyl)-(2-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 110631332 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4-methoxy-3-methylsulfonylphenyl)-(2-methylmorpholin-4-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCOC(C)C2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H19NO5S/c1-10-9-15(6-7-20-10)14(16)11-4-5-12(19-2)13(8-11)21(3,17)18/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | VWAPTPZKRHTTPB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |