C14H18N2O7S — CID 119239861
4-[4-methoxy-3-(methylsulfamoyl)benzoyl]morpholine-2-carboxylic acid (PubChem CID 119239861) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-[4-methoxy-3-(methylsulfamoyl)benzoyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[4-methoxy-3-(methylsulfamoyl)benzoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119239861 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[4-methoxy-3-(methylsulfamoyl)benzoyl]morpholine-2-carboxylic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCOC(C(=O)O)C2)ccc1OC |
| InChI | InChI=1S/C14H18N2O7S/c1-15-24(20,21)12-7-9(3-4-10(12)22-2)13(17)16-5-6-23-11(8-16)14(18)19/h3-4,7,11,15H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | PQVWUOIVYYWEPZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |