C17H23NO5S — CID 110633915
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-methoxy-3-methylsulfonylphenyl)methanone (PubChem CID 110633915) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-methoxy-3-methylsulfonylphenyl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-methoxy-3-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 110633915 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(4-methoxy-3-methylsulfonylphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCOC3CCCCC32)cc1S(C)(=O)=O |
| InChI | InChI=1S/C17H23NO5S/c1-22-15-8-7-12(11-16(15)24(2,20)21)17(19)18-9-10-23-14-6-4-3-5-13(14)18/h7-8,11,13-14H,3-6,9-10H2,1-2H3 |
| InChIKey | RSMKOMAPRSCMFQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |