C24H30N2O6S — CID 166402503
N-(4-ethylphenyl)-2-methoxy-5-[3-(oxolan-2-yl)morpholine-4-carbonyl]benzenesulfonamide (PubChem CID 166402503) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-methoxy-5-[3-(oxolan-2-yl)morpholine-4-carbonyl]benzenesulfonamide.
| Compound Name | N-(4-ethylphenyl)-2-methoxy-5-[3-(oxolan-2-yl)morpholine-4-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166402503 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-(4-ethylphenyl)-2-methoxy-5-[3-(oxolan-2-yl)morpholine-4-carbonyl]benzenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2cc(C(=O)N3CCOCC3C3CCCO3)ccc2OC)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-3-17-6-9-19(10-7-17)25-33(28,29)23-15-18(8-11-22(23)30-2)24(27)26-12-14-31-16-20(26)21-5-4-13-32-21/h6-11,15,20-21,25H,3-5,12-14,16H2,1-2H3 |
| InChIKey | JXEKIEKHPLLDAN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |