C15H20INO3 — CID 172647255
(3-iodo-4-propan-2-yloxyphenyl)-[(2R)-2-methylmorpholin-4-yl]methanone (PubChem CID 172647255) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is (3-iodo-4-propan-2-yloxyphenyl)-[(2R)-2-methylmorpholin-4-yl]methanone.
| Compound Name | (3-iodo-4-propan-2-yloxyphenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 172647255 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (3-iodo-4-propan-2-yloxyphenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
| SMILES | CC(C)Oc1ccc(C(=O)N2CCO[C@H](C)C2)cc1I |
| InChI | InChI=1S/C15H20INO3/c1-10(2)20-14-5-4-12(8-13(14)16)15(18)17-6-7-19-11(3)9-17/h4-5,8,10-11H,6-7,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | OBCVXOKYECSPDK-LLVKDONJSA-N |
| XLogP | 2.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|