C12H13BrINO2 — CID 172647300
(3-bromo-4-iodophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone (PubChem CID 172647300) has the molecular formula C12H13BrINO2 and a molecular weight of 410.05 g/mol. Its IUPAC name is (3-bromo-4-iodophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone.
| Compound Name | (3-bromo-4-iodophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 172647300 |
| Molecular Formula | C12H13BrINO2 |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | (3-bromo-4-iodophenyl)-[(2R)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(I)c(Br)c2)CCO1 |
| InChI | InChI=1S/C12H13BrINO2/c1-8-7-15(4-5-17-8)12(16)9-2-3-11(14)10(13)6-9/h2-3,6,8H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | MHQJAMPRRVKANZ-MRVPVSSYSA-N |
| XLogP | 2.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|