C19H20INO3 — CID 172647307
(4-iodo-3-phenylmethoxyphenyl)-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 172647307) has the molecular formula C19H20INO3 and a molecular weight of 437.28 g/mol. Its IUPAC name is (4-iodo-3-phenylmethoxyphenyl)-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | (4-iodo-3-phenylmethoxyphenyl)-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 172647307 |
| Molecular Formula | C19H20INO3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (4-iodo-3-phenylmethoxyphenyl)-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2ccc(I)c(OCc3ccccc3)c2)CCO1 |
| InChI | InChI=1S/C19H20INO3/c1-14-12-21(9-10-23-14)19(22)16-7-8-17(20)18(11-16)24-13-15-5-3-2-4-6-15/h2-8,11,14H,9-10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | LTAODCQNRHFFSI-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|