C19H20INO2 — CID 172647558
(3-iodo-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone (PubChem CID 172647558) has the molecular formula C19H20INO2 and a molecular weight of 421.28 g/mol. Its IUPAC name is (3-iodo-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone.
| Compound Name | (3-iodo-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 172647558 |
| Molecular Formula | C19H20INO2 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (3-iodo-4-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(OCc2ccccc2)c(I)c1)N1CCCCC1 |
| InChI | InChI=1S/C19H20INO2/c20-17-13-16(19(22)21-11-5-2-6-12-21)9-10-18(17)23-14-15-7-3-1-4-8-15/h1,3-4,7-10,13H,2,5-6,11-12,14H2 |
| InChIKey | KUWMZUGVUAMSPF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|