C23H20ClNO3 — CID 141168468
azetidin-1-yl-[3-chloro-4-(3-phenylmethoxyphenoxy)phenyl]methanone (PubChem CID 141168468) has the molecular formula C23H20ClNO3 and a molecular weight of 393.87 g/mol. Its IUPAC name is azetidin-1-yl-[3-chloro-4-(3-phenylmethoxyphenoxy)phenyl]methanone.
| Compound Name | azetidin-1-yl-[3-chloro-4-(3-phenylmethoxyphenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 141168468 |
| Molecular Formula | C23H20ClNO3 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | azetidin-1-yl-[3-chloro-4-(3-phenylmethoxyphenoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(Oc2cccc(OCc3ccccc3)c2)c(Cl)c1)N1CCC1 |
| InChI | InChI=1S/C23H20ClNO3/c24-21-14-18(23(26)25-12-5-13-25)10-11-22(21)28-20-9-4-8-19(15-20)27-16-17-6-2-1-3-7-17/h1-4,6-11,14-15H,5,12-13,16H2 |
| InChIKey | CYHFVAABPXSSQD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |