C20H22BrNO2 — CID 171369301
(6-bromo-2-methyl-3-phenylmethoxyphenyl)-piperidin-1-ylmethanone (PubChem CID 171369301) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is (6-bromo-2-methyl-3-phenylmethoxyphenyl)-piperidin-1-ylmethanone.
| Compound Name | (6-bromo-2-methyl-3-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 171369301 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (6-bromo-2-methyl-3-phenylmethoxyphenyl)-piperidin-1-ylmethanone |
| SMILES | Cc1c(OCc2ccccc2)ccc(Br)c1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H22BrNO2/c1-15-18(24-14-16-8-4-2-5-9-16)11-10-17(21)19(15)20(23)22-12-6-3-7-13-22/h2,4-5,8-11H,3,6-7,12-14H2,1H3 |
| InChIKey | HCZFQGVXEBLHIQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |