C13H14F3NO2 — CID 51710382
[(2S)-2-methylmorpholin-4-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 51710382) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is [(2S)-2-methylmorpholin-4-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(2S)-2-methylmorpholin-4-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 51710382 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [(2S)-2-methylmorpholin-4-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2ccc(C(F)(F)F)cc2)CCO1 |
| InChI | InChI=1S/C13H14F3NO2/c1-9-8-17(6-7-19-9)12(18)10-2-4-11(5-3-10)13(14,15)16/h2-5,9H,6-8H2,1H3/t9-/m0/s1 |
| InChIKey | FBTHLVCQVSQBDM-VIFPVBQESA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |