C13H13F3INO2 — CID 172647263
[3-iodo-5-(trifluoromethyl)phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 172647263) has the molecular formula C13H13F3INO2 and a molecular weight of 399.15 g/mol. Its IUPAC name is [3-iodo-5-(trifluoromethyl)phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | [3-iodo-5-(trifluoromethyl)phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 172647263 |
| Molecular Formula | C13H13F3INO2 |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | [3-iodo-5-(trifluoromethyl)phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cc(I)cc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C13H13F3INO2/c1-8-7-18(2-3-20-8)12(19)9-4-10(13(14,15)16)6-11(17)5-9/h4-6,8H,2-3,7H2,1H3/t8-/m0/s1 |
| InChIKey | LIYREUFEAVYLBN-QMMMGPOBSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|