C21H32N2O4S — CID 55654809
[3-(azepan-1-ylsulfonyl)-4-methoxyphenyl]-(3-ethylpiperidin-1-yl)methanone (PubChem CID 55654809) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is [3-(azepan-1-ylsulfonyl)-4-methoxyphenyl]-(3-ethylpiperidin-1-yl)methanone.
| Compound Name | [3-(azepan-1-ylsulfonyl)-4-methoxyphenyl]-(3-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 55654809 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [3-(azepan-1-ylsulfonyl)-4-methoxyphenyl]-(3-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCN(C(=O)c2ccc(OC)c(S(=O)(=O)N3CCCCCC3)c2)C1 |
| InChI | InChI=1S/C21H32N2O4S/c1-3-17-9-8-12-22(16-17)21(24)18-10-11-19(27-2)20(15-18)28(25,26)23-13-6-4-5-7-14-23/h10-11,15,17H,3-9,12-14,16H2,1-2H3 |
| InChIKey | TYEVSULNHCRMIC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |