C24H29N3O5S — CID 42924927
1-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)-N-phenylpiperidine-3-carboxamide (PubChem CID 42924927) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42924927 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)-N-phenylpiperidine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCC(C(=O)Nc3ccccc3)C2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C24H29N3O5S/c1-32-21-12-11-18(16-22(21)33(30,31)27-14-5-6-15-27)24(29)26-13-7-8-19(17-26)23(28)25-20-9-3-2-4-10-20/h2-4,9-12,16,19H,5-8,13-15,17H2,1H3,(H,25,28) |
| InChIKey | LFPWCCJLISGNNW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |