C20H27ClN2O5S — CID 42524067
ethyl (3S)-1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidine-3-carboxylate (PubChem CID 42524067) has the molecular formula C20H27ClN2O5S and a molecular weight of 442.97 g/mol. Its IUPAC name is ethyl (3S)-1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42524067 |
| Molecular Formula | C20H27ClN2O5S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | ethyl (3S)-1-(4-chloro-3-piperidin-1-ylsulfonylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)C1 |
| InChI | InChI=1S/C20H27ClN2O5S/c1-2-28-20(25)16-7-6-10-22(14-16)19(24)15-8-9-17(21)18(13-15)29(26,27)23-11-4-3-5-12-23/h8-9,13,16H,2-7,10-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | BAVSZVQNAVHTGS-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |