C21H30N2O4S — CID 56547072
[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]-(4-methylidenepiperidin-1-yl)methanone (PubChem CID 56547072) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is [3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]-(4-methylidenepiperidin-1-yl)methanone.
| Compound Name | [3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]-(4-methylidenepiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56547072 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]-(4-methylidenepiperidin-1-yl)methanone |
| SMILES | C=C1CCN(C(=O)c2ccc(OC)c(S(=O)(=O)N3CC(C)CC(C)C3)c2)CC1 |
| InChI | InChI=1S/C21H30N2O4S/c1-15-7-9-22(10-8-15)21(24)18-5-6-19(27-4)20(12-18)28(25,26)23-13-16(2)11-17(3)14-23/h5-6,12,16-17H,1,7-11,13-14H2,2-4H3 |
| InChIKey | UWKBPFAHUUXQAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|