C20H31N3O5S — CID 46423752
3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxy-N'-(3-methylbutanoyl)benzohydrazide (PubChem CID 46423752) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxy-N'-(3-methylbutanoyl)benzohydrazide.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxy-N'-(3-methylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 46423752 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxy-N'-(3-methylbutanoyl)benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CC(C)C)cc1S(=O)(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C20H31N3O5S/c1-13(2)8-19(24)21-22-20(25)16-6-7-17(28-5)18(10-16)29(26,27)23-11-14(3)9-15(4)12-23/h6-7,10,13-15H,8-9,11-12H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | IDQHZFMHNIPHQJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|