C21H25Cl2N3O4S — CID 55450949
N-(4-amino-3,5-dichlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzamide (PubChem CID 55450949) has the molecular formula C21H25Cl2N3O4S and a molecular weight of 486.42 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 55450949 |
| Molecular Formula | C21H25Cl2N3O4S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)cc1S(=O)(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C21H25Cl2N3O4S/c1-12-6-13(2)11-26(10-12)31(28,29)19-7-14(4-5-18(19)30-3)21(27)25-15-8-16(22)20(24)17(23)9-15/h4-5,7-9,12-13H,6,10-11,24H2,1-3H3,(H,25,27) |
| InChIKey | WOIFITJJJXWEJB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|