C25H28N2O6S — CID 26878496
3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-methoxy-N-(4-methyl-2-oxochromen-7-yl)benzamide (PubChem CID 26878496) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-methoxy-N-(4-methyl-2-oxochromen-7-yl)benzamide.
| Compound Name | 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-methoxy-N-(4-methyl-2-oxochromen-7-yl)benzamide |
|---|---|
| PubChem CID | 26878496 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-methoxy-N-(4-methyl-2-oxochromen-7-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(C)cc(=O)oc3c2)cc1S(=O)(=O)N1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C25H28N2O6S/c1-15-9-16(2)14-27(13-15)34(30,31)23-11-18(5-8-21(23)32-4)25(29)26-19-6-7-20-17(3)10-24(28)33-22(20)12-19/h5-8,10-12,15-16H,9,13-14H2,1-4H3,(H,26,29)/t15-,16-/m1/s1 |
| InChIKey | MIQRRVAJXSQNSH-HZPDHXFCSA-N |
| XLogP | 4.03 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|