C17H23NO3S — CID 124869061
1-[(3aR,5S,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone (PubChem CID 124869061) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(3aR,5S,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3aR,5S,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 124869061 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[(3aR,5S,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
| SMILES | C=CCOC[C@@H]1CC[C@@H]2[C@@H](CCN2C(=O)Cc2ccsc2)O1 |
| InChI | InChI=1S/C17H23NO3S/c1-2-8-20-11-14-3-4-15-16(21-14)5-7-18(15)17(19)10-13-6-9-22-12-13/h2,6,9,12,14-16H,1,3-5,7-8,10-11H2/t14-,15+,16+/m0/s1 |
| InChIKey | CRAUFEXDUHBNLP-ARFHVFGLSA-N |
| XLogP | 2.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|