C15H22FNO3 — CID 131684499
[(3aR,5R,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 131684499) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is [(3aR,5R,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone.
| Compound Name | [(3aR,5R,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 131684499 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [(3aR,5R,7aR)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | C=CCOC[C@H]1CC[C@@H]2[C@@H](CCN2C(=O)C2(F)CC2)O1 |
| InChI | InChI=1S/C15H22FNO3/c1-2-9-19-10-11-3-4-12-13(20-11)5-8-17(12)14(18)15(16)6-7-15/h2,11-13H,1,3-10H2/t11-,12-,13-/m1/s1 |
| InChIKey | SNZBIEGNBVWPOR-JHJVBQTASA-N |
| XLogP | 1.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|