C15H25NO2 — CID 97379132
(3aR,5R,7aR)-1-(cyclopropylmethyl)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97379132) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-(cyclopropylmethyl)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aR,5R,7aR)-1-(cyclopropylmethyl)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97379132 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (3aR,5R,7aR)-1-(cyclopropylmethyl)-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | C=CCOC[C@H]1CC[C@@H]2[C@@H](CCN2CC2CC2)O1 |
| InChI | InChI=1S/C15H25NO2/c1-2-9-17-11-13-5-6-14-15(18-13)7-8-16(14)10-12-3-4-12/h2,12-15H,1,3-11H2/t13-,14-,15-/m1/s1 |
| InChIKey | MVQHZFSIZNDRLL-RBSFLKMASA-N |
| XLogP | 2.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|