C16H21NO3S — CID 97365846
1-[(4aS,7S,7aR)-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone (PubChem CID 97365846) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-[(4aS,7S,7aR)-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(4aS,7S,7aR)-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 97365846 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[(4aS,7S,7aR)-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone |
| SMILES | C=CCO[C@H]1CC[C@H]2[C@H]1OCCN2C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C16H21NO3S/c1-2-7-19-14-4-3-13-16(14)20-8-6-17(13)15(18)10-12-5-9-21-11-12/h2,5,9,11,13-14,16H,1,3-4,6-8,10H2/t13-,14-,16+/m0/s1 |
| InChIKey | WCVRMLFDZGALEB-OFQRWUPVSA-N |
| XLogP | 2.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|