C15H21NO3S — CID 97461491
1-[(3S,3aS,7aR)-3-ethoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone (PubChem CID 97461491) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-ethoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3S,3aS,7aR)-3-ethoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 97461491 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-ethoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-thiophen-3-ylethanone |
| SMILES | CCO[C@H]1CN(C(=O)Cc2ccsc2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C15H21NO3S/c1-2-18-13-9-16(12-4-3-6-19-15(12)13)14(17)8-11-5-7-20-10-11/h5,7,10,12-13,15H,2-4,6,8-9H2,1H3/t12-,13+,15+/m1/s1 |
| InChIKey | SNIYSTDNEPJRSH-IPYPFGDCSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |