C19H27F3N2O5S — CID 155859451
1-[(4aS,7R,7aR)-7-[2-(dimethylamino)ethoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155859451) has the molecular formula C19H27F3N2O5S and a molecular weight of 452.50 g/mol. Its IUPAC name is 1-[(4aS,7R,7aR)-7-[2-(dimethylamino)ethoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4aS,7R,7aR)-7-[2-(dimethylamino)ethoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859451 |
| Molecular Formula | C19H27F3N2O5S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[(4aS,7R,7aR)-7-[2-(dimethylamino)ethoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-thiophen-3-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCO[C@@H]1CC[C@H]2[C@H]1OCCN2C(=O)Cc1ccsc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O3S.C2HF3O2/c1-18(2)6-8-21-15-4-3-14-17(15)22-9-7-19(14)16(20)11-13-5-10-23-12-13;3-2(4,5)1(6)7/h5,10,12,14-15,17H,3-4,6-9,11H2,1-2H3;(H,6,7)/t14-,15+,17+;/m0./s1 |
| InChIKey | JYYQHLPOLPDYRT-FFMLRVAQSA-N |
| XLogP | 2.26 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |