C20H25F3N2O5 — CID 155841174
1-[(4aS,7S,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-pyridin-2-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155841174) has the molecular formula C20H25F3N2O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is 1-[(4aS,7S,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-pyridin-2-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4aS,7S,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-pyridin-2-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841174 |
| Molecular Formula | C20H25F3N2O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[(4aS,7S,7aR)-7-(cyclopropylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-pyridin-2-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1ccccn1)N1CCO[C@H]2[C@@H](OCC3CC3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N2O3.C2HF3O2/c21-17(11-14-3-1-2-8-19-14)20-9-10-22-18-15(20)6-7-16(18)23-12-13-4-5-13;3-2(4,5)1(6)7/h1-3,8,13,15-16,18H,4-7,9-12H2;(H,6,7)/t15-,16-,18+;/m0./s1 |
| InChIKey | NNNJFAHRQTWKHP-IIKXTNQWSA-N |
| XLogP | 2.44 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |