C21H27F3N2O6 — CID 155827340
[(4aS,7R,7aR)-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827340) has the molecular formula C21H27F3N2O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7R,7aR)-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827340 |
| Molecular Formula | C21H27F3N2O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [(4aS,7R,7aR)-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccn1)N1CCO[C@H]2[C@H](OCC3CCOCC3)CC[C@@H]21 |
| InChI | InChI=1S/C19H26N2O4.C2HF3O2/c22-19(15-3-1-2-8-20-15)21-9-12-24-18-16(21)4-5-17(18)25-13-14-6-10-23-11-7-14;3-2(4,5)1(6)7/h1-3,8,14,16-18H,4-7,9-13H2;(H,6,7)/t16-,17+,18+;/m0./s1 |
| InChIKey | MKBFIYBABKFZKP-QQBJDQAASA-N |
| XLogP | 2.53 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |