C19H26N2O3 — CID 97461550
[(3S,3aS,7aR)-3-(cyclopentylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridin-2-ylmethanone (PubChem CID 97461550) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(cyclopentylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(cyclopentylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 97461550 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(3S,3aS,7aR)-3-(cyclopentylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@H](OCC2CCCC2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C19H26N2O3/c22-19(15-8-3-4-10-20-15)21-12-17(18-16(21)9-5-11-23-18)24-13-14-6-1-2-7-14/h3-4,8,10,14,16-18H,1-2,5-7,9,11-13H2/t16-,17+,18+/m1/s1 |
| InChIKey | KSSZPOGVVWDBNJ-SQNIBIBYSA-N |
| XLogP | 2.66 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |