C20H27NO4 — CID 97461558
[(3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-phenylmethanone (PubChem CID 97461558) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-phenylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97461558 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [(3S,3aS,7aR)-3-(oxan-4-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@H](OCC2CCOCC2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C20H27NO4/c22-20(16-5-2-1-3-6-16)21-13-18(19-17(21)7-4-10-24-19)25-14-15-8-11-23-12-9-15/h1-3,5-6,15,17-19H,4,7-14H2/t17-,18+,19+/m1/s1 |
| InChIKey | CVMGAHWLAGPKCS-QYZOEREBSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |