C20H21F3N2O5S — CID 171672902
[(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 171672902) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171672902 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1C[C@H](OCc2ccccn2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C18H20N2O3S.C2HF3O2/c21-18(13-6-9-24-12-13)20-10-16(17-15(20)5-3-8-22-17)23-11-14-4-1-2-7-19-14;3-2(4,5)1(6)7/h1-2,4,6-7,9,12,15-17H,3,5,8,10-11H2;(H,6,7)/t15-,16+,17+;/m1./s1 |
| InChIKey | UXIGRINHRLPKBW-LPZNKSAJSA-N |
| XLogP | 3.37 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |