C18H23F3N2O6 — CID 155827296
1-[(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827296) has the molecular formula C18H23F3N2O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827296 |
| Molecular Formula | C18H23F3N2O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1C[C@H](OCc2ccccn2)[C@H]2OCCC[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N2O4.C2HF3O2/c1-20-11-15(19)18-9-14(16-13(18)6-4-8-21-16)22-10-12-5-2-3-7-17-12;3-2(4,5)1(6)7/h2-3,5,7,13-14,16H,4,6,8-11H2,1H3;(H,6,7)/t13-,14+,16+;/m1./s1 |
| InChIKey | OVURIPLWIDXMFM-FNIUFUSKSA-N |
| XLogP | 1.64 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |