C22H27F3N2O5 — CID 155847370
[(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclohex-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155847370) has the molecular formula C22H27F3N2O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclohex-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclohex-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847370 |
| Molecular Formula | C22H27F3N2O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclohex-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CC=CCC1)N1CCO[C@H]2[C@H](OCc3ccccn3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N2O3.C2HF3O2/c23-20(15-6-2-1-3-7-15)22-12-13-24-19-17(22)9-10-18(19)25-14-16-8-4-5-11-21-16;3-2(4,5)1(6)7/h1-2,4-5,8,11,15,17-19H,3,6-7,9-10,12-14H2;(H,6,7)/t15?,17-,18+,19+;/m0./s1 |
| InChIKey | ZSMVFYFAXKMRIN-RKOAUADGSA-N |
| XLogP | 3.35 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|