C20H23F3N2O5 — CID 155827291
[(4aS,7S,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclopent-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155827291) has the molecular formula C20H23F3N2O5 and a molecular weight of 428.41 g/mol. Its IUPAC name is [(4aS,7S,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclopent-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7S,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclopent-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827291 |
| Molecular Formula | C20H23F3N2O5 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(4aS,7S,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-cyclopent-3-en-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CC=CC1)N1CCO[C@H]2[C@@H](Oc3cccnc3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O3.C2HF3O2/c21-18(13-4-1-2-5-13)20-10-11-22-17-15(20)7-8-16(17)23-14-6-3-9-19-12-14;3-2(4,5)1(6)7/h1-3,6,9,12-13,15-17H,4-5,7-8,10-11H2;(H,6,7)/t15-,16-,17+;/m0./s1 |
| InChIKey | LIIKGLVWLDACCC-JDFMPCBTSA-N |
| XLogP | 2.82 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|