C17H18N4O3 — CID 124794943
[(4aR,7R,7aS)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrazin-2-ylmethanone (PubChem CID 124794943) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is [(4aR,7R,7aS)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(4aR,7R,7aS)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124794943 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(4aR,7R,7aS)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCO[C@H]2[C@H]1CC[C@H]2Oc1cccnc1 |
| InChI | InChI=1S/C17H18N4O3/c22-17(13-11-19-6-7-20-13)21-8-9-23-16-14(21)3-4-15(16)24-12-2-1-5-18-10-12/h1-2,5-7,10-11,14-16H,3-4,8-9H2/t14-,15-,16+/m1/s1 |
| InChIKey | UCCGHSHTPINELS-OAGGEKHMSA-N |
| XLogP | 1.32 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |