C18H19N3O3 — CID 97380668
[(4aS,7R,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-4-ylmethanone (PubChem CID 97380668) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-4-ylmethanone.
| Compound Name | [(4aS,7R,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 97380668 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [(4aS,7R,7aR)-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCO[C@H]2[C@H](Oc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H19N3O3/c22-18(13-5-8-19-9-6-13)21-10-11-23-17-15(21)3-4-16(17)24-14-2-1-7-20-12-14/h1-2,5-9,12,15-17H,3-4,10-11H2/t15-,16+,17+/m0/s1 |
| InChIKey | YNQRDVMYKXMGIS-GVDBMIGSSA-N |
| XLogP | 1.93 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |