C19H21N3O3 — CID 97365975
[(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-3-ylmethanone (PubChem CID 97365975) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-3-ylmethanone.
| Compound Name | [(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97365975 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCO[C@H]2[C@@H](OCc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C19H21N3O3/c23-19(15-4-2-8-21-12-15)22-9-10-24-18-16(22)5-6-17(18)25-13-14-3-1-7-20-11-14/h1-4,7-8,11-12,16-18H,5-6,9-10,13H2/t16-,17-,18+/m0/s1 |
| InChIKey | ZJBJJZAHBHCNKZ-OKZBNKHCSA-N |
| XLogP | 2.07 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |