C20H26N2O3 — CID 131661730
1-[(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-cyclopent-2-en-1-ylethanone (PubChem CID 131661730) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-cyclopent-2-en-1-ylethanone.
| Compound Name | 1-[(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-cyclopent-2-en-1-ylethanone |
|---|---|
| PubChem CID | 131661730 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(4aS,7S,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-cyclopent-2-en-1-ylethanone |
| SMILES | O=C(CC1C=CCC1)N1CCO[C@H]2[C@@H](OCc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C20H26N2O3/c23-19(12-15-4-1-2-5-15)22-10-11-24-20-17(22)7-8-18(20)25-14-16-6-3-9-21-13-16/h1,3-4,6,9,13,15,17-18,20H,2,5,7-8,10-12,14H2/t15?,17-,18-,20+/m0/s1 |
| InChIKey | BBODWTUBZFDRDB-OULGXQHESA-N |
| XLogP | 2.71 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|