C20H21F3N4O5 — CID 155848717
[(4aS,7R,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155848717) has the molecular formula C20H21F3N4O5 and a molecular weight of 454.41 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7R,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848717 |
| Molecular Formula | C20H21F3N4O5 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [(4aS,7R,7aR)-7-(pyridin-3-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrimidin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccncn1)N1CCO[C@H]2[C@H](OCc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H20N4O3.C2HF3O2/c23-18(14-5-7-20-12-21-14)22-8-9-24-17-15(22)3-4-16(17)25-11-13-2-1-6-19-10-13;3-2(4,5)1(6)7/h1-2,5-7,10,12,15-17H,3-4,8-9,11H2;(H,6,7)/t15-,16+,17+;/m0./s1 |
| InChIKey | VUBVCIPPKVJBIA-NINZUIERSA-N |
| XLogP | 2.09 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |