C20H21F3N2O6 — CID 155853544
[(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155853544) has the molecular formula C20H21F3N2O6 and a molecular weight of 442.39 g/mol. Its IUPAC name is [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853544 |
| Molecular Formula | C20H21F3N2O6 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [(4aS,7R,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCO[C@H]2[C@H](OCc3ccccn3)CC[C@@H]21 |
| InChI | InChI=1S/C18H20N2O4.C2HF3O2/c21-18(16-5-3-10-22-16)20-9-11-23-17-14(20)6-7-15(17)24-12-13-4-1-2-8-19-13;3-2(4,5)1(6)7/h1-5,8,10,14-15,17H,6-7,9,11-12H2;(H,6,7)/t14-,15+,17+;/m0./s1 |
| InChIKey | XQKSBZSSNMREBF-FFMLRVAQSA-N |
| XLogP | 2.90 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |