C18H25N3O3 — CID 125232008
[(4aR,7R,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 125232008) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is [(4aR,7R,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4aR,7R,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 125232008 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [(4aR,7R,7aS)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCO[C@H]2[C@H]1CC[C@H]2OCc1ccccn1 |
| InChI | InChI=1S/C18H25N3O3/c22-18(20-9-3-4-10-20)21-11-12-23-17-15(21)6-7-16(17)24-13-14-5-1-2-8-19-14/h1-2,5,8,15-17H,3-4,6-7,9-13H2/t15-,16-,17+/m1/s1 |
| InChIKey | XNWKTTUTGDTHHE-ZACQAIPSSA-N |
| XLogP | 2.05 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |