C21H26F6N2O6 — CID 155835093
(4aS,7R,7aR)-7-(cyclopropylmethoxy)-4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155835093) has the molecular formula C21H26F6N2O6 and a molecular weight of 516.44 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-(cyclopropylmethoxy)-4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,7R,7aR)-7-(cyclopropylmethoxy)-4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155835093 |
| Molecular Formula | C21H26F6N2O6 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | (4aS,7R,7aR)-7-(cyclopropylmethoxy)-4-(pyridin-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CN2CCO[C@H]3[C@H](OCC4CC4)CC[C@@H]32)nc1 |
| InChI | InChI=1S/C17H24N2O2.2C2HF3O2/c1-2-8-18-14(3-1)11-19-9-10-20-17-15(19)6-7-16(17)21-12-13-4-5-13;2*3-2(4,5)1(6)7/h1-3,8,13,15-17H,4-7,9-12H2;2*(H,6,7)/t15-,16+,17+;;/m0../s1 |
| InChIKey | LDMJZGXDCPLFKI-WBQSDXFFSA-N |
| XLogP | 3.51 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |