C22H29F4NO5 — CID 155860327
(4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155860327) has the molecular formula C22H29F4NO5 and a molecular weight of 463.47 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155860327 |
| Molecular Formula | C22H29F4NO5 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1ccc(CN2CCO[C@H]3[C@H](OCC4CCOCC4)CC[C@@H]32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28FNO3.C2HF3O2/c21-17-3-1-15(2-4-17)13-22-9-12-24-20-18(22)5-6-19(20)25-14-16-7-10-23-11-8-16;3-2(4,5)1(6)7/h1-4,16,18-20H,5-14H2;(H,6,7)/t18-,19+,20+;/m0./s1 |
| InChIKey | NWYPAISFHPNLJL-WUHLWKCASA-N |
| XLogP | 3.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |