C20H26F3NO5 — CID 155852638
(4aS,7R,7aR)-4-[(4-methoxyphenyl)methyl]-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155852638) has the molecular formula C20H26F3NO5 and a molecular weight of 417.42 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-[(4-methoxyphenyl)methyl]-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-[(4-methoxyphenyl)methyl]-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852638 |
| Molecular Formula | C20H26F3NO5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (4aS,7R,7aR)-4-[(4-methoxyphenyl)methyl]-7-prop-2-enoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | C=CCO[C@@H]1CC[C@H]2[C@H]1OCCN2Cc1ccc(OC)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25NO3.C2HF3O2/c1-3-11-21-17-9-8-16-18(17)22-12-10-19(16)13-14-4-6-15(20-2)7-5-14;3-2(4,5)1(6)7/h3-7,16-18H,1,8-13H2,2H3;(H,6,7)/t16-,17+,18+;/m0./s1 |
| InChIKey | XYYNAKMVQIQNAD-QQBJDQAASA-N |
| XLogP | 3.26 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|