C19H23F3N2O4 — CID 155828691
(3aS,6aR)-1-[(4-methoxyphenyl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155828691) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is (3aS,6aR)-1-[(4-methoxyphenyl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-1-[(4-methoxyphenyl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828691 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (3aS,6aR)-1-[(4-methoxyphenyl)methyl]-4-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C(=O)C[C@@H]2[C@@H]1CCN2Cc1ccc(OC)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N2O2.C2HF3O2/c1-3-9-19-15-8-10-18(16(15)11-17(19)20)12-13-4-6-14(21-2)7-5-13;3-2(4,5)1(6)7/h3-7,15-16H,1,8-12H2,2H3;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | WGANSIMZZIBGAE-IDVLALEDSA-N |
| XLogP | 2.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|