C21H21F6N3O5S — CID 155864491
(3aS,6aR)-4-(pyridin-4-ylmethyl)-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155864491) has the molecular formula C21H21F6N3O5S and a molecular weight of 541.47 g/mol. Its IUPAC name is (3aS,6aR)-4-(pyridin-4-ylmethyl)-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,6aR)-4-(pyridin-4-ylmethyl)-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155864491 |
| Molecular Formula | C21H21F6N3O5S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | (3aS,6aR)-4-(pyridin-4-ylmethyl)-1-(thiophen-3-ylmethyl)-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C1C[C@@H]2[C@H](CCN2Cc2ccsc2)N1Cc1ccncc1 |
| InChI | InChI=1S/C17H19N3OS.2C2HF3O2/c21-17-9-16-15(20(17)11-13-1-5-18-6-2-13)3-7-19(16)10-14-4-8-22-12-14;2*3-2(4,5)1(6)7/h1-2,4-6,8,12,15-16H,3,7,9-11H2;2*(H,6,7)/t15-,16+;;/m0../s1 |
| InChIKey | MGAQGINJXUWZKQ-SLAHTUFOSA-N |
| XLogP | 3.79 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |