C22H26F6N2O6S — CID 155832079
4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155832079) has the molecular formula C22H26F6N2O6S and a molecular weight of 560.51 g/mol. Its IUPAC name is 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155832079 |
| Molecular Formula | C22H26F6N2O6S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 4-[[(2S,3R)-3-(2-methoxyethoxy)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]methyl]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCO[C@@H]1CCN(Cc2ccsc2)[C@H]1Cc1ccncc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N2O2S.2C2HF3O2/c1-21-9-10-22-18-4-8-20(13-16-5-11-23-14-16)17(18)12-15-2-6-19-7-3-15;2*3-2(4,5)1(6)7/h2-3,5-7,11,14,17-18H,4,8-10,12-13H2,1H3;2*(H,6,7)/t17-,18+;;/m0../s1 |
| InChIKey | MFSXASLASNFGLW-OAMYOWMRSA-N |
| XLogP | 4.26 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|