C17H23F3N2O5S — CID 155862683
(2R,3aS,6aS)-N-(2-methoxyethyl)-4-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155862683) has the molecular formula C17H23F3N2O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is (2R,3aS,6aS)-N-(2-methoxyethyl)-4-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-N-(2-methoxyethyl)-4-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155862683 |
| Molecular Formula | C17H23F3N2O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2R,3aS,6aS)-N-(2-methoxyethyl)-4-(thiophen-3-ylmethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@H]1C[C@H]2[C@H](CCN2Cc2ccsc2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O3S.C2HF3O2/c1-19-6-4-16-15(18)14-8-12-13(20-14)2-5-17(12)9-11-3-7-21-10-11;3-2(4,5)1(6)7/h3,7,10,12-14H,2,4-6,8-9H2,1H3,(H,16,18);(H,6,7)/t12-,13-,14+;/m0./s1 |
| InChIKey | MEXWOSPVDKAGRD-NPTJMSEESA-N |
| XLogP | 1.88 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|