C21H27F6N3O7 — CID 155852600
(3aR,5S,7aR)-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852600) has the molecular formula C21H27F6N3O7 and a molecular weight of 547.45 g/mol. Its IUPAC name is (3aR,5S,7aR)-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5S,7aR)-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852600 |
| Molecular Formula | C21H27F6N3O7 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | (3aR,5S,7aR)-N-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNC(=O)[C@@H]1CC[C@@H]2[C@@H](CCN2Cc2cccnc2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3.2C2HF3O2/c1-22-10-8-19-17(21)16-5-4-14-15(23-16)6-9-20(14)12-13-3-2-7-18-11-13;2*3-2(4,5)1(6)7/h2-3,7,11,14-16H,4-6,8-10,12H2,1H3,(H,19,21);2*(H,6,7)/t14-,15-,16+;;/m1../s1 |
| InChIKey | TYLNQDJKFDXGIS-DJJRUWCQSA-N |
| XLogP | 2.23 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|