C24H32F6N2O7 — CID 127023034
(3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127023034) has the molecular formula C24H32F6N2O7 and a molecular weight of 574.52 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127023034 |
| Molecular Formula | C24H32F6N2O7 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (3aR,5R,7aR)-5-(oxan-4-ylmethoxymethyl)-1-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(CN2CC[C@H]3O[C@@H](COCC4CCOCC4)CC[C@H]32)c1 |
| InChI | InChI=1S/C20H30N2O3.2C2HF3O2/c1-2-17(12-21-8-1)13-22-9-5-20-19(22)4-3-18(25-20)15-24-14-16-6-10-23-11-7-16;2*3-2(4,5)1(6)7/h1-2,8,12,16,18-20H,3-7,9-11,13-15H2;2*(H,6,7)/t18-,19-,20-;;/m1../s1 |
| InChIKey | INGCHCOBJSIFDS-OYRDCCEQSA-N |
| XLogP | 3.91 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |