C19H26F3NO5 — CID 171672597
(3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 171672597) has the molecular formula C19H26F3NO5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171672597 |
| Molecular Formula | C19H26F3NO5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (3aR,5R,7aR)-5-(cyclopropylmethoxymethyl)-1-(furan-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc(CN2CC[C@H]3O[C@@H](COCC4CC4)CC[C@H]32)co1 |
| InChI | InChI=1S/C17H25NO3.C2HF3O2/c1-2-13(1)10-20-12-15-3-4-16-17(21-15)5-7-18(16)9-14-6-8-19-11-14;3-2(4,5)1(6)7/h6,8,11,13,15-17H,1-5,7,9-10,12H2;(H,6,7)/t15-,16-,17-;/m1./s1 |
| InChIKey | FWARBRUTKCRINW-UATJXVQHSA-N |
| XLogP | 3.46 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |